|
|
| | 1,2-DIBROMOHEXAFLUOROPROPANE Basic information |
| Product Name: | 1,2-DIBROMOHEXAFLUOROPROPANE | | Synonyms: | (+/-)-1,2-DIBROMOHEXAFLUOROPROPANE;1,2-DIBROMOHEXAFLUOROPROPANE;1,2-dibromo-1,1,2,3,3,3-hexafluoro-propan;1,2-Dibromo-1,1,2,3,3,3-hexafluoropropane;Propane, 1,2-dibromo-1,1,2,3,3,3-hexafluoro-;1,2-Dibromohexafluoropropane,95%;1,2-Dibromohexafluoropropane 98%;1,2-Dibromohexafluoropropane98% | | CAS: | 661-95-0 | | MF: | C3Br2F6 | | MW: | 309.83 | | EINECS: | 211-550-8 | | Product Categories: | | | Mol File: | 661-95-0.mol |  |
| | 1,2-DIBROMOHEXAFLUOROPROPANE Chemical Properties |
| Melting point | -95 °C | | Boiling point | 73 °C | | density | 2.169 | | refractive index | 1.3605 | | Fp | 71-72°C | | Specific Gravity | 2.169 | | InChI | InChI=1S/C3Br2F6/c4-1(6,2(5,7)8)3(9,10)11 | | InChIKey | KTULQNFKNLFOHL-UHFFFAOYSA-N | | SMILES | C(Br)(F)(F)C(Br)(F)C(F)(F)F | | CAS DataBase Reference | 661-95-0(CAS DataBase Reference) | | EPA Substance Registry System | Propane, 1,2-dibromo-1,1,2,3,3,3-hexafluoro- (661-95-0) |
| Provider | Language |
|
ALFA
| English |
| | 1,2-DIBROMOHEXAFLUOROPROPANE Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | 1,2-Dibromohexafluoropropane is used in method of manufacturing fire-extinguishing microcapsules comprising fire-extinguishing agent and polymeric shell. |
| | 1,2-DIBROMOHEXAFLUOROPROPANE Preparation Products And Raw materials |
| Raw materials | Fluorosulfuric acid, 1,1,2,3,3,3-hexafluoropropyl ester-->2-Bromo-1,1,1,3,3,3-hexafluoropropane-->HEPTAFLUORO-N-PROPYL BROMIDE-->1,1,1,3,3,3-Hexafluoropropane-->2-BROMOHEPTAFLUOROPROPANE-->bromine trifluoromethanesulfonate-->TRIFLUOROMETHANESULFONIC ACID TRIFLUOROMETHYL ESTER-->Water-->Heptafluorobutyric acid-->Hexafluoropropylene | | Preparation Products | N,N-Diethyl-1,1,2,3,3,3-hexafluoropropylamine-->BROMODIFLUOROMETHANE |
|