- 4-Bromo-3-methylpyridine
-
- $1.10 / 1g
-
2025-11-18
- CAS:10168-00-0
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons min
|
| | 4-Bromo-3-methylpyridine Basic information |
| | 4-Bromo-3-methylpyridine Chemical Properties |
| Boiling point | 211 ºC | | density | 1.494 | | Fp | 82 ºC | | storage temp. | Keep Cold | | pka | 3.58±0.10(Predicted) | | InChI | InChI=1S/C6H6BrN/c1-5-4-8-3-2-6(5)7/h2-4H,1H3 | | InChIKey | GYUAOSJIGMDMNJ-UHFFFAOYSA-N | | SMILES | C1=NC=CC(Br)=C1C | | CAS DataBase Reference | 10168-00-0(CAS DataBase Reference) |
| | 4-Bromo-3-methylpyridine Usage And Synthesis |
| Uses | 4-Bromo-3-methylpyridine can be used in organic synthetic materials. Its derivatives are also used as antimicrobial compounds. |
| | 4-Bromo-3-methylpyridine Preparation Products And Raw materials |
|