|
|
| | 2-Chloro-4-(trifluoromethyl)pyridine Basic information |
| | 2-Chloro-4-(trifluoromethyl)pyridine Chemical Properties |
| Melting point | -19°C | | Boiling point | 146-147 °C(lit.) | | density | 1.411 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4490(lit.) | | Fp | 127 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform, Methanol (Sparingly) | | pka | -1.34±0.10(Predicted) | | form | Oil | | color | Colourless | | BRN | 4246276 | | InChI | InChI=1S/C6H3ClF3N/c7-5-3-4(1-2-11-5)6(8,9)10/h1-3H | | InChIKey | GBNPVXZNWBWNEN-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=CC(C(F)(F)F)=C1 | | CAS DataBase Reference | 81565-18-6(CAS DataBase Reference) |
| Hazard Codes | Xi,T,F | | Risk Statements | 10-36/37/38-25-11 | | Safety Statements | 26-36-45-36/37/39-22-16 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29333990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Chloro-4-(trifluoromethyl)pyridine Usage And Synthesis |
| Chemical Properties | Light yellow liquid | | Uses | 2-Chloro-4-(trifluoromethyl)pyridine may be used in the synthesis of:
- 4,4′-bis( trifluoromethyl)-2,2′-bipyridine
- 4-(trifluoromethyl)pyridine
- 1,3-bis(4-(trifluoromethyl)pyridin-2-yl)benzene
| | General Description | 2-Chloro-4-(trifluoromethyl)pyridine can be synthesized from 2-chloro-4-iodopyridine. |
| | 2-Chloro-4-(trifluoromethyl)pyridine Preparation Products And Raw materials |
|