|
|
| | 1-(4-NITROPHENYLAZO)-2-NAPHTHOL Basic information |
| Product Name: | 1-(4-NITROPHENYLAZO)-2-NAPHTHOL | | Synonyms: | 1-((4-nitrophenyl)azo)-2-naphthaleno;1-((4-nitrophenyl)azo)-2-naphtho;1-[(4-nitrophenyl)azo]-2-naphthaleno;LABOTEST-BB LT00454132;1-(P-NITROPHENYLAZO)-2-NAPHTHOL;1-(P-NITROPHENYLAZO)-2-NAPHTHOL PARA RED;1-(4-NITROPHENYLAZO)-2-NAPHTHOL;1-[(4-nitrofenyl)diazenyl]-2-naftol | | CAS: | 6410-10-2 | | MF: | C16H11N3O3 | | MW: | 293.28 | | EINECS: | 229-093-8 | | Product Categories: | | | Mol File: | 6410-10-2.mol |  |
| | 1-(4-NITROPHENYLAZO)-2-NAPHTHOL Chemical Properties |
| Melting point | 248-252 °C | | Boiling point | 435.13°C (rough estimate) | | density | 1.2211 (rough estimate) | | refractive index | 1.6500 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly, Heated) | | pka | 13.45±0.50(Predicted) | | form | solid | | Colour Index | 12070 | | color | Red | | λmax | 488 nm | | BRN | 680469 | | Stability: | Stable. Incompatible with strong oxidizing agents. | | Major Application | cleaning products cosmetics food and beverages personal care | | InChI | 1S/C16H11N3O3/c20-15-10-5-11-3-1-2-4-14(11)16(15)18-17-12-6-8-13(9-7-12)19(21)22/h1-10,20H | | InChIKey | WOTPFVNWMLFMFW-UHFFFAOYSA-N | | SMILES | Oc1ccc2ccccc2c1N=Nc3ccc(cc3)[N+]([O-])=O | | CAS DataBase Reference | 6410-10-2(CAS DataBase Reference) | | EPA Substance Registry System | C.I. Pigment Red 1 (6410-10-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36-26-36/37/39 | | WGK Germany | 3 | | RTECS | QL4510000 | | TSCA | TSCA listed | | HS Code | 29270000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-(4-NITROPHENYLAZO)-2-NAPHTHOL Usage And Synthesis |
| Chemical Properties | solid | | Uses | Para Red is used as a fat soluble chemical dye and food additive. It is a banned colorant and a number of analytical techniques have been developed to detect it in food. | | Biological Activity | Para Red may be used to make standards for analysis. | | Purification Methods | Crystallise this dye from AcOH or xylene and dry it in vacuo. It has max at 488nm. [Beilstein 16 II 70.] |
| | 1-(4-NITROPHENYLAZO)-2-NAPHTHOL Preparation Products And Raw materials |
|