- 1,1-Difluoro-2-iodoethane
-
- $3.00 / 25KG
-
2025-10-13
- CAS:598-39-0
- Min. Order: 0.1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2-IODO-1,1-DIFLUOROETHANE Basic information |
| Product Name: | 2-IODO-1,1-DIFLUOROETHANE | | Synonyms: | 1,1-DIFLUORO-2-IODOETHANE;2-IODO-1,1-DIFLUOROETHANE;NISTC598390;1,1-Difluoro-2-iodoethane97%;3-Iodo-2,6-difluorobenzoicacid;1,1-difluoro-1-iodoethane;1,1-difluoro-1-iodo-ethane;1,1-Difluoro-2-iodoethane 97% | | CAS: | 598-39-0 | | MF: | C2H3F2I | | MW: | 191.95 | | EINECS: | | | Product Categories: | | | Mol File: | 598-39-0.mol |  |
| | 2-IODO-1,1-DIFLUOROETHANE Chemical Properties |
| Boiling point | 89-90°C | | density | 2.180 | | refractive index | 1.4577 | | form | liquid | | color | Clear, almost colourless | | InChI | InChI=1S/C2H3F2I/c3-2(4)1-5/h2H,1H2 | | InChIKey | VMFCTZUYOILUMY-UHFFFAOYSA-N | | SMILES | C(F)(F)CI |
| | 2-IODO-1,1-DIFLUOROETHANE Usage And Synthesis |
| Chemical Properties | Colorless liquid |
| | 2-IODO-1,1-DIFLUOROETHANE Preparation Products And Raw materials |
|