|
|
| | 5-CYCLOPROPYL-2H-PYRAZOL-3-YLAMINE Basic information | | Physical Form |
| | 5-CYCLOPROPYL-2H-PYRAZOL-3-YLAMINE Chemical Properties |
| Boiling point | 367.5±30.0 °C(Predicted) | | density | 1.159 g/mL at 25 °C | | refractive index | n20/D1.566 | | Fp | >110℃ | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | liquid | | pka | 15.84±0.10(Predicted) | | Appearance | Yellow to brown Oil | | Water Solubility | Slightly soluble in water. | | Sensitive | Air Sensitive | | InChI | InChI=1S/C6H9N3/c7-6-3-5(8-9-6)4-1-2-4/h3-4H,1-2H2,(H3,7,8,9) | | InChIKey | MXVAGCQKBDMKPG-UHFFFAOYSA-N | | SMILES | N1C(C2CC2)=CC(N)=N1 |
| | 5-CYCLOPROPYL-2H-PYRAZOL-3-YLAMINE Usage And Synthesis |
| Physical Form | Liquid | | Uses | It is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff. |
| | 5-CYCLOPROPYL-2H-PYRAZOL-3-YLAMINE Preparation Products And Raw materials |
|