|
|
| | 5-Chloro-2-fluorobenzoic acid Basic information |
| | 5-Chloro-2-fluorobenzoic acid Chemical Properties |
| Melting point | 152-157 °C (lit.) | | Boiling point | 274.7±20.0 °C(Predicted) | | density | 1.477±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO, Methanol | | pka | 2.90±0.10(Predicted) | | form | Solid | | color | White | | BRN | 2614286 | | InChI | InChI=1S/C7H4ClFO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11) | | InChIKey | WGAVMKXCDMQVNF-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(Cl)=CC=C1F | | CAS DataBase Reference | 394-30-9(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 5-chloro-2-fluoro- (394-30-9) |
| | 5-Chloro-2-fluorobenzoic acid Usage And Synthesis |
| Chemical Properties | White crystaline powder | | Uses | 5-Chloro-2-fluorobenzoic Acid (cas# 394-30-9) is a compound useful in organic synthesis. |
| | 5-Chloro-2-fluorobenzoic acid Preparation Products And Raw materials |
|