N,N,N',N'-tetraethyldiethylenetriamine manufacturers
|
| | N,N,N',N'-tetraethyldiethylenetriamine Basic information |
| Product Name: | N,N,N',N'-tetraethyldiethylenetriamine | | Synonyms: | 3,9-diethyl-3,6,9-triazaundecane;1,2-Ethanediamine, N-2-(diethylamino)ethyl-N,N-diethyl-;1 1 7 7-TETRAETHYLDIETHYLENETRIAMINE 90%;N'-(2-diethylaminoethyl)-N,N-diethyl-ethane-1,2-diamine;N'-(2-diethylaminoethyl)-N,N-diethylethane-1,2-diamine;N,N,N',N'-TetraethyldiethylenetriaMine technical grade, 90%;n’-[2-(diethylamino)ethyl]-n,n-diethyl-2-ethanediamine;N,N,N',N'-TETRAETHYLDIETHYLENETRIAMINE | | CAS: | 123-12-6 | | MF: | C12H29N3 | | MW: | 215.38 | | EINECS: | 204-603-1 | | Product Categories: | Nitrogen Compounds;Organic Building Blocks;Polyamines | | Mol File: | 123-12-6.mol |  |
| | N,N,N',N'-tetraethyldiethylenetriamine Chemical Properties |
| Boiling point | 130-135 °C(lit.) | | density | 0.837 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.448(lit.) | | Fp | 208 °F | | pka | 10.45±0.25(Predicted) | | form | liquid | | InChI | InChI=1S/C12H29N3/c1-5-14(6-2)11-9-13-10-12-15(7-3)8-4/h13H,5-12H2,1-4H3 | | InChIKey | UICCSKORMGVRCB-UHFFFAOYSA-N | | SMILES | C(N(CC)CC)CNCCN(CC)CC | | EPA Substance Registry System | 1,2-Ethanediamine, N'-[2-(diethylamino)ethyl]-N,N-diethyl- (123-12-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 2735 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | Toxicity | LD50 ivn-mus: 180 mg/kg CSLNX* NX#01684 |
| | N,N,N',N'-tetraethyldiethylenetriamine Usage And Synthesis |
| Uses | N,N,N′,N′-Tetraethyldiethylenetriamine (TEDETA) has been used in the following studies:
- As N-substituted ethylenediamine ligand in the synthesis of [Ni(Et4dien)(NO2)2] (Et4dien=N,N,N′,N′-tetraethyldiethylenetriamine).
- As a reagent in the synthesis of adamantanyl connector, (2-(1-carbamoylmethyladamantane)di(ethyl(diethylmethylammonium))dichloride).
- As a reagent in the synthesis of aminated macroligand.
- As a reagent in the synthesis of precipiton ligand.
- As a multimodal ligand in the synthesis of P(S-DVB)-g-P(S-GMA)- TEDETA beads (poly(styrene-divinylbenzene)-graft-poly(styrene-glycidylmethacrylate)).
| | General Description | N,N,N′,N′-Tetraethyldiethylenetriamine (TEDETA) is an N-substituted ethylenediamine ligand. Its boiling point, density and refractive index have been determined. | | Safety Profile | Poison by intravenous route.When heated to decomposition it emits toxic fumes ofNOx. |
| | N,N,N',N'-tetraethyldiethylenetriamine Preparation Products And Raw materials |
|