| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Aromsyn Co., Ltd. |
| Tel: |
+86-0571-85585865 +86-13336024896 |
| Email: |
CB@aromsyn.com |
|
| | 2,4,6-Trimethylbenzenesulfonyl fluoride Basic information |
| | 2,4,6-Trimethylbenzenesulfonyl fluoride Chemical Properties |
| Melting point | 65-70°C | | InChI | 1S/C9H11FO2S/c1-6-4-7(2)9(8(3)5-6)13(10,11)12/h4-5H,1-3H3 | | InChIKey | TXJKOBLXPGOYOS-UHFFFAOYSA-N | | SMILES | FS(C1=C(C)C=C(C)C=C1C)(=O)=O |
| RIDADR | UN 3261 8 / PGII | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
| | 2,4,6-Trimethylbenzenesulfonyl fluoride Usage And Synthesis |
| Uses | Sulfonyl fluoride motif can be used as a connector for the assembly of -SO2- linked small molecules with proteins or nucleic acids. This new click chemistry approach through sulfates is a complimentary approach to using amides and phosphate groups as linkers. | | reaction suitability | reaction type: click chemistry |
| | 2,4,6-Trimethylbenzenesulfonyl fluoride Preparation Products And Raw materials |
|