| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | 2'-Dicyclohexylphosphino-2,6-dimethoxy-3-sulfonato-1,1'-biphenyl hydrate sodium salt Basic information | | Reactions |
| Product Name: | 2'-Dicyclohexylphosphino-2,6-dimethoxy-3-sulfonato-1,1'-biphenyl hydrate sodium salt | | Synonyms: | Sodium 2μ-dicyclohexylphosphino-2,6-dimethoxy-1,1μ-biphenyl-3-sulfonate hydrate;SPhos (water soluble);2'-(Dicyclohexylphosphino)-2,6-dimethoxy-[1,1'-biphenyl]-3-sulfonic acid sodium salt hydrate (1:1:1);2'-Dicyclohexylphosphino-2,6-dimethoxy-3-sulfonato-1,1'-biphenyl hydrate sodium salt (water soluble SPhos);Sodium 2'-(dicyclohexylphosphanyl)-2,6-dimethoxy-[1,1'-biphenyl]-3-sulfonate hydrate;Sodium 2'-dicycL;-3-suL;2'-(Dicyclohexylphosphino)-2,6-dimethoxy-[1,1'-biphenyl]-3-sulfonic acid sodium salt hydrate | | CAS: | 1049726-96-6 | | MF: | C26H36NaO6PS | | MW: | 530.59 | | EINECS: | | | Product Categories: | Achiral Phosphine;Aryl Phosphine;Buchwald Ligands Series;Buchwald Ligands&Precatalysts | | Mol File: | Mol File |  |
| | 2'-Dicyclohexylphosphino-2,6-dimethoxy-3-sulfonato-1,1'-biphenyl hydrate sodium salt Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | color | light yellow | | InChIKey | MAPQBSXKBDVINV-UHFFFAOYSA-M | | SMILES | O.[Na+].COc1ccc(c(OC)c1-c2ccccc2P(C3CCCCC3)C4CCCCC4)S([O-])(=O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2'-Dicyclohexylphosphino-2,6-dimethoxy-3-sulfonato-1,1'-biphenyl hydrate sodium salt Usage And Synthesis |
| Reactions | General ligand for the Pd-catalyzed Suzuki-Miyaura coupling reaction of aryl chlorides and for the coupling of challenging substrate combinations in water.
| | Uses | Sodium 2’-Dicyclohexylphosphino-2,6-dimethoxy-1,1’-biphenyl-3-sulfonate hydrate is a useful building block, used in the patented preparation of phenanthrene lactam derivatives for their anticancer activity. | | Uses | Sulfonated ligand for palladium-catalyzed Suzuki-Miyaura coupling under aqueous conditions facilitating isolation of the organic products. | | reaction suitability | reaction type: Cross Couplings
reagent type: ligand
reaction type: Suzuki-Miyaura Coupling |
| | 2'-Dicyclohexylphosphino-2,6-dimethoxy-3-sulfonato-1,1'-biphenyl hydrate sodium salt Preparation Products And Raw materials |
|