| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
SIGMA-RBI |
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
|
| | Methyl-14(S),15(S)-epoxy-13(R)-hydroxy-5(Z),8(Z),11(Z)-eicosatrienoate Basic information |
| | Methyl-14(S),15(S)-epoxy-13(R)-hydroxy-5(Z),8(Z),11(Z)-eicosatrienoate Chemical Properties |
| Fp | -26 °C | | storage temp. | −20°C | | form | hexane solution | | InChIKey | DBXPKRNKMVEUMA-LLNXGUOUSA-N | | SMILES | CCCCCC1OC1[C@H](O)\C=C/C\C=C/C\C=C/CCCC(=O)OC |
| Hazard Codes | F,Xn,N | | Risk Statements | 11-38-48/20-51/53-62-65-67 | | Safety Statements | 36/37-61-62-33-29-16-9 | | RIDADR | UN 1208 3/PG 2 | | WGK Germany | 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Chronic 2
Asp. Tox. 1
Flam. Liq. 2
Repr. 2
Skin Irrit. 2
STOT RE 1 Inhalation
STOT SE 3 |
| | Methyl-14(S),15(S)-epoxy-13(R)-hydroxy-5(Z),8(Z),11(Z)-eicosatrienoate Usage And Synthesis |
| | Methyl-14(S),15(S)-epoxy-13(R)-hydroxy-5(Z),8(Z),11(Z)-eicosatrienoate Preparation Products And Raw materials |
|