|
|
| | Phenyltris(dimethylsiloxy)silane Basic information |
| Product Name: | Phenyltris(dimethylsiloxy)silane | | Synonyms: | Phenyl-tri(diMethylsiloxy)silane;3-[(dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-phenyl-trisiloxan;3-[(dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-phenyl-Trisiloxane;PHENYLTRIS(DIMETHYLSILOXY)SILANE;TRIS(DIMETHYLSILYLOXY)PHENYLSILANE;Tris(dimethylsiloxy)phenylsilane;TRIS(DIMETHYLSILYLOXY)PHENYLSILANE 96%;Trisiloxane,3-[(dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-phenyl- | | CAS: | 18027-45-7 | | MF: | C12H26O3Si4 | | MW: | 330.67 | | EINECS: | 241-940-3 | | Product Categories: | | | Mol File: | 18027-45-7.mol |  |
| | Phenyltris(dimethylsiloxy)silane Chemical Properties |
| Melting point | <0°C | | Boiling point | 91 °C2 mm Hg(lit.) | | density | 0.942 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.442(lit.) | | Fp | 188 °F | | storage temp. | Storage temp. 2-8°C | | form | clear liquid | | Specific Gravity | 0.942 | | color | Colorless to Almost colorless | | Hydrolytic Sensitivity | 3: reacts with aqueous base | | BRN | 3380327 | | Cosmetics Ingredients Functions | FILM FORMING | | InChI | InChI=1S/C12H26O3Si4/c1-16(2)13-19(14-17(3)4,15-18(5)6)12-10-8-7-9-11-12/h7-11,16-18H,1-6H3 | | InChIKey | CQZDNELEZXTFEH-UHFFFAOYSA-N | | SMILES | [SiH](C)(C)O[Si](O[SiH](C)C)(C1=CC=CC=C1)O[SiH](C)C | | CAS DataBase Reference | 18027-45-7(CAS DataBase Reference) | | EPA Substance Registry System | Trisiloxane, 3-[(dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-phenyl- (18027-45-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-21 | | TSCA | TSCA listed | | HS Code | 29319090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Phenyltris(dimethylsiloxy)silane Usage And Synthesis |
| Description | Phenyltris(dimethylsiloxy)silane, miscibility with dimethyl siloxane, liquid silicone rubber, phenyl silicone rubber and phenyl resin. It's used as crosslinker of liquid silicone rubber, phenyl silicone rubber and phenyl resin.
|
| | Phenyltris(dimethylsiloxy)silane Preparation Products And Raw materials |
|