| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:2-(2-Aminothiazol-4-yl)-4-methylphenol
CAS:103037-98-5
Purity:2-(2-Aminothiazol-4-yl)-4-methylphenol Package:1G Remarks:JRD1192-1G
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:2-(2-Aminothiazol-4-yl)-4-methylphenol
CAS:103037-98-5
|
| Company Name: |
Heterocyclics Inc
|
| Tel: |
732-444-6336 |
| Email: |
info@heterocyclics.com |
| Products Intro: |
Product Name:JR-13977, 2-(2-Aminothiazol-4-yl)-4-methylphenol, 95%
CAS:103037-98-5
|
| Company Name: |
Princeton BioMolecular Research, Inc.
|
| Tel: |
732 355 9920 ext. 102 |
| Email: |
info@princetonbio.com |
| Products Intro: |
Product Name:2-(2-Amino-thiazol-4-yl)-4-methyl-phenol
CAS:103037-98-5
Package:10g
|
| Company Name: |
Interbioscreen Ltd.
|
| Tel: |
+7 (49) 6524-0091 |
| Email: |
screen@ibscreen.chg.ru |
| Products Intro: |
CAS:103037-98-5
Purity:95% Package:1mg Remarks:C10H10N2OS
|
|
| | 2-(2-Amino-thiazol-4-yl)-4-methyl-phenol Basic information |
| Product Name: | 2-(2-Amino-thiazol-4-yl)-4-methyl-phenol | | Synonyms: | JR-13977, 2-(2-Aminothiazol-4-yl)-4-methylphenol, 95%;2-(2-Amino-thiazol-4-yl)-4-methyl-phenol;2-(2-Imino-2,3-dihydrothiazol-4-yl)-4-methylphenol;Phenol, 2-(2-amino-4-thiazolyl)-4-methyl- | | CAS: | 103037-98-5 | | MF: | C10H10N2OS | | MW: | 206.26 | | EINECS: | | | Product Categories: | | | Mol File: | 103037-98-5.mol |  |
| | 2-(2-Amino-thiazol-4-yl)-4-methyl-phenol Chemical Properties |
| Melting point | 160 °C(Solv: ethanol (64-17-5)) | | Boiling point | 397.0±27.0 °C(Predicted) | | density | 1.335±0.06 g/cm3(Predicted) | | pka | 8.78±0.43(Predicted) | | form | solid | | InChI | 1S/C11H11NOS/c1-7-3-4-11(13)9(5-7)10-6-14-8(2)12-10/h3-6,13H,1-2H3 | | InChIKey | GNLUONSQMQRANA-UHFFFAOYSA-N | | SMILES | CC1=CC(C2=CSC(C)=N2)=C(O)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1 |
| | 2-(2-Amino-thiazol-4-yl)-4-methyl-phenol Usage And Synthesis |
| | 2-(2-Amino-thiazol-4-yl)-4-methyl-phenol Preparation Products And Raw materials |
|