| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | (1R,2S)-2-(aminomethyl)-N,N-bis(1,1,2,2,2-pentadeuterioethyl)-1-phenylcyclopropane-1-carboxamide:hydrochloride Basic information |
| Product Name: | (1R,2S)-2-(aminomethyl)-N,N-bis(1,1,2,2,2-pentadeuterioethyl)-1-phenylcyclopropane-1-carboxamide:hydrochloride | | Synonyms: | (1R,2S)-2-(aminomethyl)-N,N-bis(1,1,2,2,2-pentadeuterioethyl)-1-phenylcyclopropane-1-carboxamide:hydrochloride;[2H10]- (±)-Milnacipran Hydrochloride;Milnacipran hydrochloride salt;D-Milnacipran D10 hydrochlorideQ: What is
D-Milnacipran D10 hydrochloride Q: What is the CAS Number of
D-Milnacipran D10 hydrochloride Q: What is the storage condition of
D-Milnacipran D10 hydrochloride Q: What are the applications of
D-Milnacipran D10 hydrochloride;Levomilnacipran-d10 Hydrochloride;Minapulen D10 hydrochloride;Milnacipran-D10 hydrochloride solution;(±)-Milnacipran -d10 Hydrochloride | | CAS: | 1217774-40-7 | | MF: | C15H23ClN2O | | MW: | 282.81 | | EINECS: | | | Product Categories: | | | Mol File: | 1217774-40-7.mol |  |
| | (1R,2S)-2-(aminomethyl)-N,N-bis(1,1,2,2,2-pentadeuterioethyl)-1-phenylcyclopropane-1-carboxamide:hydrochloride Chemical Properties |
| storage temp. | -20°C | | form | liquid | | Major Application | clinical testing | | InChI | 1S/C15H22N2O.ClH/c1-3-17(4-2)14(18)15(10-13(15)11-16)12-8-6-5-7-9-12;/h5-9,13H,3-4,10-11,16H2,1-2H3;1H/t13-,15+;/m0./s1/i1D3,2D3,3D2,4D2; | | InChIKey | XNCDYJFPRPDERF-XHWGGYTQSA-N | | SMILES | O=C(N(C([2H])([2H])C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])[2H])[C@]1(C2=CC=CC=C2)[C@@H](C1)CN.Cl |
| WGK Germany | WGK 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
| | (1R,2S)-2-(aminomethyl)-N,N-bis(1,1,2,2,2-pentadeuterioethyl)-1-phenylcyclopropane-1-carboxamide:hydrochloride Usage And Synthesis |
| Uses | The labelled analogue of the (1R-cis)-enatiomer of Milnacipran (M344600). A selective norepinephrine and serotonin reuptake inhibitor approved for the management of fibromyalgia. |
| | (1R,2S)-2-(aminomethyl)-N,N-bis(1,1,2,2,2-pentadeuterioethyl)-1-phenylcyclopropane-1-carboxamide:hydrochloride Preparation Products And Raw materials |
|