- ABEI
-
- $2.20 / 100KG
-
2025-10-13
- CAS:66612-29-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons
|
| | N-(4-Aminobutyl)-N-ethylisoluminol Basic information |
| | N-(4-Aminobutyl)-N-ethylisoluminol Chemical Properties |
| Melting point | 259-260 °C (lit.) | | density | 1.206±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | glacial acetic acid: 50mg/mL, clear, colorless to yellow | | form | powder to crystal | | pka | 10.83±0.20(Predicted) | | color | White to Light yellow | | BRN | 920895 | | InChI | 1S/C14H20N4O2/c1-2-18(8-4-3-7-15)10-5-6-11-12(9-10)14(20)17-16-13(11)19/h5-6,9H,2-4,7-8,15H2,1H3,(H,16,19)(H,17,20) | | InChIKey | LEOJISUPFSWNMA-UHFFFAOYSA-N | | SMILES | CCN(CCCCN)c1ccc2C(=O)NNC(=O)c2c1 | | CAS DataBase Reference | 66612-29-1(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 8-10-23 | | HazardClass | IRRITANT | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | N-(4-Aminobutyl)-N-ethylisoluminol Usage And Synthesis |
| Chemical Properties | White to light yellow powder to crystal | | Uses | ABEI is a biochemical reagent that can be used as a biological material or organic compound for life science related research. | | Definition | ChEBI: ABEI is a member of phthalazines. |
| | N-(4-Aminobutyl)-N-ethylisoluminol Preparation Products And Raw materials |
|