O-CRESOL-D8 manufacturers
- O-CRESOL-D8
-
- $0.00 / 1KG
-
2025-06-27
- CAS:203645-65-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
- O-CRESOL-D8
-
- $0.00 / 1kg
-
2024-11-04
- CAS:203645-65-2
- Min. Order: 1000kg
- Purity: 99.5%
- Supply Ability: 20T
- O-CRESOL-D8
-
- $7.00 / 1KG
-
2019-07-10
- CAS:203645-65-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100KG
|
| | O-CRESOL-D8 Basic information |
| | O-CRESOL-D8 Chemical Properties |
| Melting point | 32-34 °C(lit.) | | Boiling point | 191 °C(lit.) | | density | 1.126 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.543(lit.) | | Fp | 178 °F | | form | solid | | InChI | 1S/C7H8O/c1-6-4-2-3-5-7(6)8/h2-5,8H,1H3/i1D3,2D,3D,4D,5D/hD | | InChIKey | QWVGKYWNOKOFNN-IWRLGKISSA-N | | SMILES | [2H]Oc1c([2H])c([2H])c([2H])c([2H])c1C([2H])([2H])[2H] | | CAS DataBase Reference | 203645-65-2(CAS DataBase Reference) | | CAS Number Unlabeled | 95-48-7 |
| Hazard Codes | T | | Risk Statements | 24/25-34 | | Safety Statements | 36/37/39-45 | | RIDADR | UN 3455 6.1/PG 2 | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Oral
Aquatic Chronic 2
Eye Dam. 1
Skin Corr. 1B |
| | O-CRESOL-D8 Usage And Synthesis |
| | O-CRESOL-D8 Preparation Products And Raw materials |
|