- Nandrolone Propionate
-
- $10.00 / 1box
-
2025-10-31
- CAS:
- Min. Order: 1box
- Purity: 99%
- Supply Ability: 1000Kilogram/Month
- Nandrolone Propionate
-
- $1150.00 / 1kg
-
2025-10-26
- CAS:7207-92-3
- Min. Order: 1kg
- Purity: 99
- Supply Ability: 999
|
| | Nandrolone 17-propionate Basic information |
| | Nandrolone 17-propionate Chemical Properties |
| Melting point | 55-60° | | alpha | D23.5 +58° in chloroform (Rao) | | Boiling point | 453.6±45.0 °C(Predicted) | | density | 1.11±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 2 mg/ml | | form | Solid | | color | White to Off-White | | Merck | 13,6391 | | InChI | InChI=1/C21H30O3/c1-3-20(23)24-19-9-8-18-17-6-4-13-12-14(22)5-7-15(13)16(17)10-11-21(18,19)2/h12,15-19H,3-11H2,1-2H3/t15-,16+,17+,18-,19-,21-/s3 | | InChIKey | LGRKCTFWUWAKON-XRESXOMQNA-N | | SMILES | [C@@]12([H])CC[C@H](OC(=O)CC)[C@@]1(C)CC[C@]1([H])[C@@]3([H])CCC(=O)C=C3CC[C@@]21[H] |&1:0,4,10,14,16,26,r| | | CAS DataBase Reference | 7207-92-3(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 40-48 | | Safety Statements | 22-24/25 | | RIDADR | UN 2811 | | HazardClass | 6.1(b) | | PackingGroup | III |
| | Nandrolone 17-propionate Usage And Synthesis |
| Uses | Nandrolone 17-Propionate is an anabolic steroid. | | benefits | Nandrolone propionate (Nandrolone 17-propionate) is an anabolic steroid with a relatively long duration of action primarily consisting of androgenic and nitrogen-retentive properties.
|
| | Nandrolone 17-propionate Preparation Products And Raw materials |
|