|
|
| | ETHYL-BETA-IODOPROPIONATE Basic information |
| Product Name: | ETHYL-BETA-IODOPROPIONATE | | Synonyms: | ETHYL-BETA-IODOPROPIONATE;Ethyl-B-Iodopropionate;ETHYL-3-IODOPROPIONATE;3-Iodopropanoic acid ethyl ester;Ethyl-beta-iodopropinonate;Propanoic acid, 3-iodo-, ethyl ester;Ethyl-β-iodopropionate;Ethyl -iodopropionate | | CAS: | 6414-69-3 | | MF: | C5H9IO2 | | MW: | 228.03 | | EINECS: | | | Product Categories: | | | Mol File: | 6414-69-3.mol |  |
| | ETHYL-BETA-IODOPROPIONATE Chemical Properties |
| Boiling point | 203℃ | | density | 1.709 | | refractive index | 1.4961 | | Fp | 76℃ | | storage temp. | 2-8°C(protect from light) | | Appearance | Light yellow to yellow Liquid | | InChI | InChI=1S/C5H9IO2/c1-2-8-5(7)3-4-6/h2-4H2,1H3 | | InChIKey | KZTNQOAFISZIEI-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)CCI |
| | ETHYL-BETA-IODOPROPIONATE Usage And Synthesis |
| Uses | Ethyl-beta-iodopropionate |
| | ETHYL-BETA-IODOPROPIONATE Preparation Products And Raw materials |
| Raw materials | Nonanoic acid, 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-, ethyl ester-->3-IODOPROPIONIC ACID-->Magnesium, (1-ethoxycyclopropanolato)iodo--->Perfluoro-1-iodohexane-->1-ethoxycyclopropanol-->Ethyl propionate-->Ethanol-->Ethyl acrylate-->Ethyl 3-chloropropionate-->Ethyl 3-bromopropionate-->Ethyl bromoacetate | | Preparation Products | TRANS-2-BUTENE-1,4-DICARBOXYLIC ACID-->Ethyl 3-methylthiopropionate |
|