PERFLUORO(2-METHYL-3-OXAHEXANOIC) ACID manufacturers
|
| | PERFLUORO(2-METHYL-3-OXAHEXANOIC) ACID Basic information |
| Product Name: | PERFLUORO(2-METHYL-3-OXAHEXANOIC) ACID | | Synonyms: | Propanoic acid, 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-;2,3,3-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoic acid fluoro ester;2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoic acid;2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propionic acid;2-(Heptafluoropropoxy)-2,3,3,3-tetrafluoropropanoic acid;Perfluoro-2-propoxypropanoic acid;Perfluoro-2-propoxypropionic acid;Perfluoro-alpha-propoxypropionic acid | | CAS: | 13252-13-6 | | MF: | C6HF11O3 | | MW: | 330.05 | | EINECS: | 236-236-8 | | Product Categories: | | | Mol File: | 13252-13-6.mol |  |
| | PERFLUORO(2-METHYL-3-OXAHEXANOIC) ACID Chemical Properties |
| Boiling point | 60°C 10mm | | density | 1.748±0.06 g/cm3(Predicted) | | Fp | 60°C/10mm | | storage temp. | 2-8°C | | solubility | Benzene (Slightly), Chloroform (Sparingly), DMSO (Sparingly), Methanol (Slightly) | | pka | -1.36±0.10(Predicted) | | form | liquid | | color | Colourless | | Major Application | PFAS testing | | InChI | 1S/C6HF11O3/c7-2(1(18)19,4(10,11)12)20-6(16,17)3(8,9)5(13,14)15/h(H,18,19) | | InChIKey | CSEBNABAWMZWIF-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(=O)O | | EPA Substance Registry System | Hexafluoropropylene oxide dimer acid (13252-13-6) |
| Hazard Codes | C,Xi | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 3265 | | WGK Germany | WGK 3 | | Hazard Note | Corrosive | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 2918999090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Skin Corr. 1B
STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | PERFLUORO(2-METHYL-3-OXAHEXANOIC) ACID Usage And Synthesis |
| Uses | 2,3,3,3-Tetrafluoro-2-(1,1,2,2,3,3,3,heptafluoropropoxy)propanoic Acid is a standard for environmental testing and research. Identification of novel perfluoroalkyl ether carboxylic acids and sulfonic acids in natural waters using accurate mass time-of-flight mass spectrometry. | | Definition | ChEBI: 2,3,3,3-tetrafluoro-2-(heptafluoropropoxy)propanoic acid is a perfluorinated compound that is 2-propoxypentanoic acid in which all 11 of the hydrogens attached to carbon atoms have been replaced by fluorine atoms. Used as an alternative to perfluorooctanoic acid in the fluoropolymer industry for years, its widespread environmental distribution, high bioaccumulation capability, and human exposure have caused great concern, particularly as its potential toxicity and health risk is still largely unknown. It is a monocarboxylic acid, a perfluorinated compound and an ether. |
| | PERFLUORO(2-METHYL-3-OXAHEXANOIC) ACID Preparation Products And Raw materials |
|