|
|
| | 4,5-Dihydro-6-methylpyridazin-3(2H)-one Basic information | | Uses |
| Product Name: | 4,5-Dihydro-6-methylpyridazin-3(2H)-one | | Synonyms: | 4,5-dihydro-6-methyl-3(2h)-pyridazinon;4,5-dihydro-6-methyl-3(2h)-pyridazinone;6-METHYL-2,3,4,5-TETRAHYDROPYRIDAZIN-3-ONE;6-methyl-2,4-dihydro-1H-pyridazin-3-one;AKOS BBS-00008246;4,5-DIHYDRO-6-METHYL-3(2H)-PYRIDAZINONE HYDRATE;4,5-DIHYDRO-6-METHYLPYRIDAZIN-3(2H)-ONE;6-Methyl-4,5-dihydro-3-pyridazone | | CAS: | 5157-08-4 | | MF: | C5H8N2O | | MW: | 112.13 | | EINECS: | | | Product Categories: | Pyridines, Pyrimidines, Purines and Pteredines | | Mol File: | 5157-08-4.mol |  |
| | 4,5-Dihydro-6-methylpyridazin-3(2H)-one Chemical Properties |
| Melting point | 79-83 °C | | Boiling point | 265-270 °C | | density | 1.24±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 14.09±0.40(Predicted) | | color | White to Almost white | | BRN | 107612 | | InChI | InChI=1S/C5H8N2O/c1-4-2-3-5(8)7-6-4/h2-3H2,1H3,(H,7,8) | | InChIKey | VOTFXESXPPEARL-UHFFFAOYSA-N | | SMILES | C1(=O)NN=C(C)CC1 | | CAS DataBase Reference | 5157-08-4(CAS DataBase Reference) |
| | 4,5-Dihydro-6-methylpyridazin-3(2H)-one Usage And Synthesis |
| Uses | 6-Methyl-2,3,4,5-tetrahydropyridazin-3-one (cas# 5157-08-4) is a useful research chemical. | | Definition | ChEBI: 6-Methyl-2,3,4,5-tetrahydropyridazin-3-one is a member of pyridazines. |
| | 4,5-Dihydro-6-methylpyridazin-3(2H)-one Preparation Products And Raw materials |
|