|
|
| | METHYL (R)-(+)-3-BROMO-2-METHYLPROPIONATE Basic information |
| | METHYL (R)-(+)-3-BROMO-2-METHYLPROPIONATE Chemical Properties |
| Boiling point | 85 °C37 mm Hg(lit.) | | density | 1.422 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.455 | | Fp | 165 °F | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | Appearance | Colorless to light yellow Liquid | | Optical Rotation | [α]20/D +16°, neat | | BRN | 1720833 | | InChI | InChI=1S/C5H9BrO2/c1-4(3-6)5(7)8-2/h4H,3H2,1-2H3/t4-/m0/s1 | | InChIKey | FKWNAVCXZSQYTA-BYPYZUCNSA-N | | SMILES | C(OC)(=O)[C@@H](C)CBr |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2915907098 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | METHYL (R)-(+)-3-BROMO-2-METHYLPROPIONATE Usage And Synthesis |
| Uses | Methyl (R)-(+)-3-bromo-2-methylpropionate can be used as a reactant to prepare:
- (S)-3-(6-Methoxy-pyridin-3-yl)-2-methylpropionic acid methylester by reacting with 5-bromo-2-methoxy pyridine via nucleophilic displacement reaction.
- Decahydroisoquinoline derivative (NVP-ACQ090) as a potent antagonist of somatostatin sst3 receptor.
It can also be used as a reference compound in the enantioselective alkylation reaction of hydrophobic vitamin B12 derivatives. |
| | METHYL (R)-(+)-3-BROMO-2-METHYLPROPIONATE Preparation Products And Raw materials |
|