|
|
| | PYRROLIDIN-1-YL-ACETIC ACID Basic information |
| Product Name: | PYRROLIDIN-1-YL-ACETIC ACID | | Synonyms: | AKOS BBS-00000323;AKOS BC-0363;1-PYRROLIDINEACETIC ACID;1-PYRROLIDINYLACETIC ACID;N-PYRROLIDINOACETIC ACID;SALOR-INT L481092-1EA;PYRROLIDIN-1-YL-ACETIC ACID;RARECHEM AL BO 0350 | | CAS: | 37386-15-5 | | MF: | C6H11NO2 | | MW: | 129.16 | | EINECS: | | | Product Categories: | | | Mol File: | 37386-15-5.mol |  |
| | PYRROLIDIN-1-YL-ACETIC ACID Chemical Properties |
| Melting point | 184-185 °C | | Boiling point | 233.8±23.0 °C(Predicted) | | density | 1.153±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly, Sonicated, Heated), Methanol (Slightly) | | form | Solid | | pka | 2.47±0.10(Predicted) | | color | Pale Yellow | | InChI | InChI=1S/C6H11NO2/c8-6(9)5-7-3-1-2-4-7/h1-5H2,(H,8,9) | | InChIKey | IPXNXMNCBXHYLQ-UHFFFAOYSA-N | | SMILES | N1(CC(O)=O)CCCC1 |
| Hazard Codes | Xi | | HazardClass | IRRITANT |
| | PYRROLIDIN-1-YL-ACETIC ACID Usage And Synthesis |
| Uses | 1-?Pyrrolidineacetic Acid is a useful reactant and reagent in organic reactions. It can be found used in cosmetic products such as wrinkle-?preventive?/ameliorating products. | | Synthesis | b) Synthesis of 2-(pyrrolidin-1-yl)acetic acid: ethyl 2-(pyrrolidin-1-yl)acetate (2 g, 12.7 mmol, 1.0 eq.) was dissolved in 8N HCl and the reaction was stirred for 16 hrs. at 95°C. Upon completion of the reaction, the mixture was concentrated, the reaction was quenched and extracted as in Intermediate Example 15(b). Subsequently, the solvent was removed by distillation to afford the target product 2-(pyrrolidin-1-yl)acetic acid in 91% (1.5 g) yield. The product was analyzed by LC-MS (ESI): calculated mass 129.1; measured mass 130.1 [M + H]+ (retention time: 0.26 min). | | References | [1] Patent: WO2013/53983, 2013, A1. Location in patent: Page/Page column 40
[2] Patent: US2015/11548, 2015, A1. Location in patent: Paragraph 0161
[3] Liebigs Annalen der Chemie, 1983, # 6, p. 950 - 961 |
| | PYRROLIDIN-1-YL-ACETIC ACID Preparation Products And Raw materials |
|