Diethyl ethyl n-propyl malonate manufacturers
|
| | Diethyl ethyl n-propyl malonate Basic information |
| Product Name: | Diethyl ethyl n-propyl malonate | | Synonyms: | ETHYL-N-PROPYLMALONIC ACID DIETHYL ESTER;DIETHYL ETHYL PROPYL MALONATE;Valproic Acid Impurity 18;Valproic acid impurity 5;2-Ethyl-2-propyl-malonic acid diethyl ester;Propanedioic acid, 2-ethyl-2-propyl-, 1,3-diethyl ester;Valproate Sodium Impurity 18;diethyl 2-ethyl-2-propylpropanedioate | | CAS: | 6065-62-9 | | MF: | C12H22O4 | | MW: | 230.3 | | EINECS: | | | Product Categories: | | | Mol File: | 6065-62-9.mol |  |
| | Diethyl ethyl n-propyl malonate Chemical Properties |
| storage temp. | Store at room temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C12H22O4/c1-5-9-12(6-2,10(13)15-7-3)11(14)16-8-4/h5-9H2,1-4H3 | | InChIKey | ZXENWBHSTGAEEW-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(CC)(CCC)C(OCC)=O |
| | Diethyl ethyl n-propyl malonate Usage And Synthesis |
| | Diethyl ethyl n-propyl malonate Preparation Products And Raw materials |
|