- Fmoc-D-Gln(Trt)-OH
-
- $0.00/ kg
-
2026-01-06
- CAS:200623-62-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
|
| | N-Fmoc-N'-trityl-D-glutamine Basic information |
| | N-Fmoc-N'-trityl-D-glutamine Chemical Properties |
| Melting point | 232-237°C | | Boiling point | 873.5±65.0 °C(Predicted) | | density | 1.256 | | storage temp. | 2-8°C | | solubility | Acetonitrile (Slightly), Chloroform (Slightly), DMF (Sparingly) | | form | Solid | | pka | 3.73±0.10(Predicted) | | color | White to Off-White | | Optical Rotation | [α]22/D +13.4°, c = 1% in DMF | | InChIKey | RJOWDRCXXHFWKO-PGUFJCEWSA-N | | SMILES | C(O)(=O)[C@@H](CCC(N)=O)N(C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)C(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 | | CAS DataBase Reference | 200623-62-7(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 29242990 |
| | N-Fmoc-N'-trityl-D-glutamine Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Fmoc-D-Gln(Trt)-OH, is an amino acid derivative used in chemical synthesis and peptide chemistry. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | N-Fmoc-N'-trityl-D-glutamine Preparation Products And Raw materials |
|