|
|
| | 3-BROMO-4-METHOXYBENZOIC ACID Basic information |
| | 3-BROMO-4-METHOXYBENZOIC ACID Chemical Properties |
| Melting point | 220-222 °C (lit.) | | Boiling point | 326.0±27.0 °C(Predicted) | | density | 1.625±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), methanol (Slightly) | | form | Solid | | pka | 4.08±0.10(Predicted) | | color | White to Off-White | | BRN | 2087585 | | InChI | InChI=1S/C8H7BrO3/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4H,1H3,(H,10,11) | | InChIKey | BBPZABXVRBFWGD-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(OC)C(Br)=C1 | | CAS DataBase Reference | 99-58-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29189900 |
| | 3-BROMO-4-METHOXYBENZOIC ACID Usage And Synthesis |
| Chemical Properties | White powder | | Uses | 3-Bromo-4-methoxybenzoic acid is used as a reagent to prepare benzamide compounds that act as ABL1, ABL2, and BCR-ABL1 inhibitors for treating cancer and CNS disorders. |
| | 3-BROMO-4-METHOXYBENZOIC ACID Preparation Products And Raw materials |
|