|
|
| | N-Acetyl-D-methionine Basic information |
| | N-Acetyl-D-methionine Chemical Properties |
| Melting point | 103-106 °C | | Boiling point | 453.6±40.0 °C(Predicted) | | density | 1.202±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | form | Crystalline | | pka | 3.50±0.10(Predicted) | | color | White | | BRN | 1725553 | | InChI | 1S/C7H13NO3S/c1-5(9)8-6(7(10)11)3-4-12-2/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11)/t6-/m1/s1 | | InChIKey | XUYPXLNMDZIRQH-ZCFIWIBFSA-N | | SMILES | CSCC[C@@H](NC(C)=O)C(O)=O | | CAS DataBase Reference | 1509-92-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29309070 | | Storage Class | 11 - Combustible Solids |
| | N-Acetyl-D-methionine Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | N-Acetyl-D-methionine may be used as a substrate to identify, differentiate and characterized N-acylamino acid racemase(s) and N-acyl-D-amino acid amidohydrolase(s). | | Definition | ChEBI: An N-acetyl-D-amino acid in which the amino acid is D-methionine. | | Synthesis Reference(s) | Journal of the American Chemical Society, 73, p. 4604, 1951 DOI: 10.1021/ja01154a030 |
| | N-Acetyl-D-methionine Preparation Products And Raw materials |
|