|
|
| | 2-Butanethiol Basic information |
| Product Name: | 2-Butanethiol | | Synonyms: | 2-BUTANETHIOL 98+%;SEC-BUTYL MERCAPTAN 93+%;S-Butanethiol;Butan-2-thiol;1-METHYL-1-PROPANETHIOL 98%;sec-Butyl mercaptan, Mercaptan C4;Inchi=1/C4H10S/C1-3-4(2)5/H4-5H,3H2,1-2h;2-BUTANETHIOL FOR SYNTHESIS 5 ML | | CAS: | 513-53-1 | | MF: | C4H10S | | MW: | 90.19 | | EINECS: | 208-165-2 | | Product Categories: | thiol Flavor | | Mol File: | 513-53-1.mol |  |
| | 2-Butanethiol Chemical Properties |
| Melting point | -165° | | Boiling point | 84.6-85.2 °C(lit.) | | density | 0.83 g/mL at 25 °C(lit.) | | vapor pressure | 142 mm Hg ( 37.7 °C) | | refractive index | n20/D 1.436(lit.) | | Fp | 70 °F | | storage temp. | Store below +30°C. | | solubility | 1.32g/l | | form | liquid | | pka | 10.92±0.10(Predicted) | | color | Colorless to Almost colorless | | Specific Gravity | 0.83 | | Odor | sulfurous | | Odor Threshold | 0.00003ppm | | explosive limit | 1.7-9.6%(V) | | Merck | 14,1578 | | InChI | 1S/C4H10S/c1-3-4(2)5/h4-5H,3H2,1-2H3 | | InChIKey | LOCHFZBWPCLPAN-UHFFFAOYSA-N | | SMILES | SC(CC)C | | LogP | 2.180 | | CAS DataBase Reference | 513-53-1(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Butanethiol(513-53-1) | | EPA Substance Registry System | 2-Butanethiol (513-53-1) |
| Hazard Codes | F,Xi | | Risk Statements | 11-36/37/38 | | Safety Statements | 16-26-36 | | RIDADR | UN 2347 3/PG 2 | | WGK Germany | 3 | | F | 13 | | TSCA | TSCA listed | | HazardClass | 3.1 | | PackingGroup | II | | HS Code | 29309070 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 2 | | Hazardous Substances Data | 513-53-1(Hazardous Substances Data) | | Toxicity | LD50 orally in Rabbit: 5176 mg/kg LD50 dermal Rabbit > 2000 mg/kg |
| | 2-Butanethiol Usage And Synthesis |
| Uses | sec-Butyl Mercaptan is used in the preparation of arylsulfides via palladium catalyzed thioetherification of aryl bromides and iodides. | | Purification Methods | Purify it as for 1-butanethiol. [Beilstein 1 IV 1584.] |
| | 2-Butanethiol Preparation Products And Raw materials |
|