|
|
| | Bis(triphenylphosphine)nickel(II)chloride Basic information | | Reaction |
| | Bis(triphenylphosphine)nickel(II)chloride Chemical Properties |
| Melting point | 250 °C (dec.)(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Crystals or Powder | | color | Dark green to dark gray | | Water Solubility | insoluble | | Sensitive | Hygroscopic | | Exposure limits | NIOSH: IDLH 10 mg/m3; TWA 0.015 mg/m3 | | InChI | InChI=1S/2C18H15P.2ClH.Ni/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*1-15H;2*1H;/q;;;;+2/p-2 | | InChIKey | ZBRJXVVKPBZPAN-UHFFFAOYSA-L | | SMILES | P(C1C=CC=CC=1)(C1=CC=CC=C1)C1C=CC=CC=1.P(C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1.[Ni](Cl)Cl | | CAS DataBase Reference | 14264-16-5(CAS DataBase Reference) | | NIST Chemistry Reference | dichlorobis(triphenylphosphine)nickel(14264-16-5) | | EPA Substance Registry System | Nickel, dichlorobis(triphenylphosphine)- (14264-16-5) |
| Hazard Codes | T | | Risk Statements | 45-43-52/53-34-20/21/22 | | Safety Statements | 53-36/37-45-60-36/37/39-26 | | RIDADR | 3260 | | WGK Germany | 3 | | RTECS | QR6170000 | | F | 21 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29310095 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3
toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Aquatic Chronic 3
Carc. 1B
Skin Sens. 1 |
| | Bis(triphenylphosphine)nickel(II)chloride Usage And Synthesis |
| Reaction |
- Catalyst for hydrosilylation of styrene with diphenysilane
- Catalyst for carboxylation of various aryl chlorides and other derivatives
- Catalyst for C–P cross-coupling reactions of diphenylphosphine oxide with aryl chloride
- Catalyst for N?Heterocyclic carbene-assisted cross-coupling reactions of diarylborinic acids with aryl chlorides,tosylates, and sulfamates.
- Catalyst for Negishi biaryl ketone synthesis by cross-coupling of amides with aryl zinc halides via carbon-nitrogen bond cleavage.
| | Chemical Properties | dark green to dark grey crystals or powder | | Uses | Coordination compund. | | Uses | suzuki reaction | | Uses | Dichlorobis(triphenylphosphine)nickel(II) is used as a catalyst for cross-coupling of Grignard reagents, hydrosilylations, hydrogenation and polymerization. | | reaction suitability | core: nickel
reagent type: catalyst | | Purification Methods | Wash it with glacial AcOH and dry it in a vacuum over H2SO4 and KOH until AcOH is removed. [Venanzi J Chem Soc 719 1958, Kocienski et al. J Org Chem 54 1215 1989, Beilstein 16 IV 953.] |
| | Bis(triphenylphosphine)nickel(II)chloride Preparation Products And Raw materials |
|