|
|
| | TETRAETHYL METHYLENEDIPHOSPHONATE Basic information |
| Product Name: | TETRAETHYL METHYLENEDIPHOSPHONATE | | Synonyms: | methylenedi-phosphonicacitetraethylester;METHYLENEDIPHOSPHONIC ACID TETRAETHYL ESTER;AURORA KA-1506;BIS(DIETHOXYPHOSPHINYL)METHANE;TETRAETHYL(METHYLENE)BISPHOSPHONATE;TETRAETHYL METHYLENEDIPHOSPHONATE;Tetraethyl methylenediphosphonate, 98+%;methanediyl-bis-phosphonic acid tetraethyl ester | | CAS: | 1660-94-2 | | MF: | C9H22O6P2 | | MW: | 288.21 | | EINECS: | 216-764-5 | | Product Categories: | Naphthyridine,Quinoline;Other;OLED | | Mol File: | 1660-94-2.mol |  |
| | TETRAETHYL METHYLENEDIPHOSPHONATE Chemical Properties |
| Boiling point | 171-174 °C11 mm Hg(lit.) | | density | 1.16 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.442(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Liquid | | color | Clear yellow to yellow-brown | | Specific Gravity | 1.160 | | Water Solubility | Slightly miscible with water. | | BRN | 1813241 | | InChI | InChI=1S/C9H22O6P2/c1-5-12-16(10,13-6-2)9-17(11,14-7-3)15-8-4/h5-9H2,1-4H3 | | InChIKey | STJWVOQLJPNAQL-UHFFFAOYSA-N | | SMILES | C(P(=O)(OCC)OCC)P(=O)(OCC)OCC | | CAS DataBase Reference | 1660-94-2(CAS DataBase Reference) | | EPA Substance Registry System | Phosphonic acid, methylenebis-, tetraethyl ester (1660-94-2) |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | SZ9150000 | | Hazard Note | Corrosive | | TSCA | TSCA listed | | HS Code | 29319090 | | Storage Class | 10 - Combustible liquids | | Toxicity | mouse,LD50,intravenous,180mg/kg (180mg/kg),U.S. Army Armament Research & Development Command, Chemical Systems Laboratory, NIOSH Exchange Chemicals. Vol. NX#03139, |
| | TETRAETHYL METHYLENEDIPHOSPHONATE Usage And Synthesis |
| Chemical Properties | clear yellow to yellow-brown liquid | | Uses | Tetraethyl methylidenebisphosphonate, can be used in the synthesis of tetrazoloquinoline-based mono- and bisphosphonate esters as potent anti-inflammatory agents. It is also an intermediate for the synthesis of new bisphosphonate and bisphosphonic acid derivatives with anticancer and antischistosomal activity. | | Uses | Reactant for synthesis of:
- Dual substrate-site inhibitors of 3-deoxy-D-arabino-heptulosonate 7-phosphate synthase
- Unnatural alpha-amino acid derivatives containing gem-biphosphonates
- Biphenyl sulfonylamino Me bisphosphonic acids as inhibitors of matrix metalloproteinases and bone resorption
- Lycopene via Wittig-Horner reaction
- Alkylaminoethylbisphosphinic acids to target farnesyl diphosphate synthase
- Aromatic bisphosphonates for use as inhibitors of geranylgeranyl diphosphate synthase
Precursor for synthesis of dendritic polyglycerol anions used toward L-selectin inhibition | | Synthesis Reference(s) | Synthetic Communications, 20, p. 1865, 1990 DOI: 10.1080/00397919008053112
Tetrahedron Letters, 34, p. 1515, 1993 DOI: 10.1016/S0040-4039(00)60333-7 | | reaction suitability | reaction type: C-C Bond Formation |
| | TETRAETHYL METHYLENEDIPHOSPHONATE Preparation Products And Raw materials |
|