|
|
| | 5-Chloro-2,3-difluoropyridine Basic information |
| | 5-Chloro-2,3-difluoropyridine Chemical Properties |
| Melting point | 47-49 C | | Boiling point | 135°C | | density | 1.442 g/mL at 25 °C | | refractive index | 1.4738 | | Fp | 135°C | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | -5.14±0.20(Predicted) | | form | Oil | | color | Clear Colourless | | BRN | 4177319 | | InChI | InChI=1S/C5H2ClF2N/c6-3-1-4(7)5(8)9-2-3/h1-2H | | InChIKey | PERMDYZFNQIKBL-UHFFFAOYSA-N | | SMILES | C1(F)=NC=C(Cl)C=C1F | | CAS DataBase Reference | 89402-43-7(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-52/53-10-36/37/38-20/21/22 | | Safety Statements | 23-36-61-26 | | RIDADR | 2810 | | WGK Germany | 3 | | Hazard Note | Harmful | | HazardClass | IRRITANT | | HazardClass | 3 | | PackingGroup | III | | HS Code | 2933399990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 3
Flam. Liq. 3 |
| Provider | Language |
|
ALFA
| English |
| | 5-Chloro-2,3-difluoropyridine Usage And Synthesis |
| Uses | 5-Chloro-2,3-difluoropyridine is a 2,3,5-trihalopyridine used in the preparation of the herbicides and pesticides such as chodinafop-propargyl. | | Synthesis | General procedure for the synthesis of 2,3-difluoro-5-chloropyridine from 2,3,5-trichloropyridine: First, 400 g of cyclobutanesulfone and 400 g of dimethylsulfoxide were added to a 1000 mL flask, and dehydrated to a moisture content of less than 0.05% at 200 °C under 0.05 MPa (negative pressure). Subsequently, 96 g (1.66 mol) of potassium fluoride, 120 g (0.67 mol) of 2,3,5-trichloropyridine, 2 g of 18-crown ether, and 3 g of potassium carbonate were added to the reaction flask at 120 °C and heated to 200 °C for about 3 hours. After completion of the reaction, the product was collected to give 95 g (0.51 mol) of 2,3-difluoro-5-chloropyridine in 90% yield. The purity of the product was 96.8% as determined by gas chromatography. | | References | [1] Patent: CN106008329, 2016, A. Location in patent: Paragraph 0008; 0009
[2] Synthetic Communications, 2004, vol. 34, # 23, p. 4301 - 4311
[3] Patent: US33478, 1990, E1
[4] Patent: US4565568, 1986, A
[5] Patent: US4678509, 1987, A |
| | 5-Chloro-2,3-difluoropyridine Preparation Products And Raw materials |
|