- Fmoc-L-His(Trt)-OH
-
-
2026-08-21
- CAS:109425-51-6
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
- Fmoc-His(Trt)-OH
-
-
2026-08-21
- CAS:109425-51-6
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 500kgs
|
| | Fmoc-His(Trt)-OH Basic information |
| | Fmoc-His(Trt)-OH Chemical Properties |
| Melting point | 150-155 °C(lit.) | | alpha | +86.0 °(D/25)(c=5%inCHCl3) | | Boiling point | 811.7±65.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | refractive index | 97 ° (C=5, CHCl3) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.06±0.10(Predicted) | | form | Powder | | color | White to off-white | | Optical Rotation | [α]/D 87±5°, c = 1 in chloroform | | Water Solubility | Slightly soluble in water. | | Sensitive | Moisture Sensitive | | BRN | 5204720 | | Major Application | peptide synthesis | | InChIKey | XXMYDXUIZKNHDT-QNGWXLTQSA-N | | SMILES | OC(=O)[C@H](Cc1cn(cn1)C(c2ccccc2)(c3ccccc3)c4ccccc4)NC(=O)OCC5c6ccccc6-c7ccccc57 | | CAS DataBase Reference | 109425-51-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-24/25 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 2933 29 90 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-His(Trt)-OH Usage And Synthesis |
| Chemical Properties | White to off-white solid powder, soluble in water but poorly soluble in ethanol and insoluble in ether. Its structure contains a unique imidazole unit. The imidazole group can form a coordination compound with Fe2+ or other metal ions to promote the absorption of iron, so it can be used to prevent and treat anemia. | | Uses | Fmoc-His(Trt)-OH is used in the synthesis and application of Fmoc-His(3-Bum)-OH. | | General Description |
Fmoc-His(Trt)-OH has fmoc group to protect -αNH2, it can be used as a building block in solid-phase peptide synthesis (SPPS).
| | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis | | Synthesis | In a dry reaction flask, N-deprotected amino acids were dissolved in 0.15 M sodium carbonate (2~3 equiv.), and then an acetone solution ( 0.1 M) of 9-fluorenylmethyl-N-succinimidyl carbonate (1~1.2 equiv.) was added to the above reaction mixture. Water was added to the reaction system to adjust the pH of the reaction system to 9~10. The resulting reaction mixture was stirred at room temperature for 4 h. At the end of the reaction, the resulting reaction mixture was concentrated at 30 C under reduced pressure to remove the acetone, and the resulting residue was diluted with H2O and the pH of the solution was adjusted to 9~10 with sodium carbonate 0.6 M. The resultant solution was extracted twice with ether. The pH of the aqueous phase was adjusted to 4-5 by slowly adding 10 % citric acid to the resulting organic solution, the organic layer was separated and dried with anhydrous sodium sulfate, the desiccant was removed by filtration and the resulting filtrate was concentrated under vacuum, and the resulting crude product was purified by silica gel column chromatography to obtain the molecules of N-Fmoc-N'-trityl-L-histidine. |
| | Fmoc-His(Trt)-OH Preparation Products And Raw materials |
|