| Company Name: |
BioBioPha Co., Ltd. Gold
|
| Tel: |
0871-65217109 13211707573; |
| Email: |
y.liu@mail.biobiopha.com |
| Products Intro: |
Product Name:(±)-Pinoresinol
CAS:4263-88-1
Purity:97.0% Package:5mg Remarks:BBP03363
|
PINORESINOL manufacturers
- (±)-Pinoresinol
-
- $0.00 / 5mg
-
2023-02-24
- CAS:4263-88-1
- Min. Order: 5mg
- Purity: ≥97%(HPLC)
- Supply Ability: 10 g
|
| | PINORESINOL Basic information |
| Product Name: | PINORESINOL | | Synonyms: | PINORESINOL;PINORESINOL DIGLUCOPYRANOSIDE;Phenol, 4,4'-[(1R,3aS,4R,6aS)-tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diyl]bis[2-methoxy-, rel-;DL-Pinoresinol;(±)-Pinoresinol | | CAS: | 4263-88-1 | | MF: | C20H22O6 | | MW: | 358.39 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | PINORESINOL Chemical Properties |
| Melting point | 144-145℃ | | Boiling point | 556.5±50.0 °C(Predicted) | | density | 1.287±0.06 g/cm3(Predicted) | | pka | 9.54±0.35(Predicted) | | InChI | InChI=1/C20H22O6/c1-23-17-7-11(3-5-15(17)21)19-13-9-26-20(14(13)10-25-19)12-4-6-16(22)18(8-12)24-2/h3-8,13-14,19-22H,9-10H2,1-2H3/t13-,14-,19+,20+/s3 | | InChIKey | HGXBRUKMWQGOIE-VVZREXRKNA-N | | SMILES | O1C[C@@]2([H])[C@H](C3=CC=C(O)C(OC)=C3)OC[C@@]2([H])[C@@H]1C1=CC=C(O)C(OC)=C1 |&1:2,4,16,18,r| |
| | PINORESINOL Usage And Synthesis |
| Uses | (±)-Pinoresinol is a potent antifungal agent. (±)-Pinoresinol shows antifungal activity[1]. | | References | [1] Kim SY, et al. Effect of Pinoresinol and Vanillic Acid Isolated from Catalpa bignonioides on Mouse Myoblast Proliferation via the Akt/mTOR Signaling Pathway. Molecules. 2022 Aug 24;27(17):5397. DOI:10.3390/molecules27175397 |
| | PINORESINOL Preparation Products And Raw materials |
|