|
|
| | 1-Hexyl-3-methylimidazolium chloride Basic information |
| | 1-Hexyl-3-methylimidazolium chloride Chemical Properties |
| Melting point | -85 °C | | density | 1.0337 | | refractive index | 1.514-1.518 | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | color | Colorless to Yellow | | Water Solubility | Insoluble in water. | | BRN | 8356525 | | InChI | 1S/C10H19N2.ClH/c1-3-4-5-6-7-12-9-8-11(2)10-12;/h8-10H,3-7H2,1-2H3;1H/q+1;/p-1 | | InChIKey | NKRASMXHSQKLHA-UHFFFAOYSA-M | | SMILES | [Cl-].CCCCCCn1cc[n+](C)c1 | | CAS DataBase Reference | 171058-17-6(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 23-24/25-37/39-26 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 29339900 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | 1-Hexyl-3-methylimidazolium chloride Usage And Synthesis |
| Conductivity | 0.08 mS/cm | | Chemical Properties | Clear yellow-orange liquid | | Uses | 1-n-Hexyl-3-methylimidazolium chloride, is used as an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff. | | Definition | ChEBI: 1-hexyl-3-methylimidazolium chloride is an organic chloride salt in which the cationic component is 1-hexyl-3-methylimidazolium. It contains a 1-hexyl-3-methylimidazolium. | | General Description | 1-hexyl-3-methylimidazolium chloride is an ionic liquid (IL). Its surface and bulk properties in aqueous solution at various temperatures indicates that it behaves as a short-chain cationic surfactant and shows aggregation behavior. |
| | 1-Hexyl-3-methylimidazolium chloride Preparation Products And Raw materials |
|