|
|
| | 9,9-BIS(4-AMINO-3-FLUOROPHENYL)FLUORENE Basic information |
| Product Name: | 9,9-BIS(4-AMINO-3-FLUOROPHENYL)FLUORENE | | Synonyms: | 2,2'-DIFLUORO-4,4'-(9-FLUORENYLIDENE)DIANILINE;9,9-BIS(4-AMINO-3-FLUOROPHENYL)FLUORENE;9,9-BIS(4-AMINO-3-FLUOROPHENYL)FLUORENE 98+% T;9,9-Bis(3-fluoro-4-aminophenyl)fluorene;4,4'-(9H-Fluorene-9,9-diyl)bis(2-fluoroaniline);9,9-Bis(3-fluoro-4-aminophenyl)fluorene(FFDA);4,4'-(9H-Fluorene-9,9-diyl);bis(2-fluoroaniline) | | CAS: | 127926-65-2 | | MF: | C25H18F2N2 | | MW: | 384.42 | | EINECS: | | | Product Categories: | Fluorenes;Fluorenes & Fluorenones | | Mol File: | 127926-65-2.mol |  |
| | 9,9-BIS(4-AMINO-3-FLUOROPHENYL)FLUORENE Chemical Properties |
| Boiling point | 523.1±50.0 °C(Predicted) | | density | 1.334 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | almost transparency in THF | | pka | 3.52±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | Water Solubility | Insoluble in water | | InChI | InChI=1S/C25H18F2N2/c26-21-13-15(9-11-23(21)28)25(16-10-12-24(29)22(27)14-16)19-7-3-1-5-17(19)18-6-2-4-8-20(18)25/h1-14H,28-29H2 | | InChIKey | RXNKCIBVUNMMAD-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(N)C(F)=C2)(C2=CC=C(N)C(F)=C2)C2=C(C=CC=C2)C2=C1C=CC=C2 |
| | 9,9-BIS(4-AMINO-3-FLUOROPHENYL)FLUORENE Usage And Synthesis |
| Uses | 9,9-Bis(4-amino-3-fluorophenyl)fluorene (FFDA) is a diamine organic compound that can be used to prepare polyimide (PI) materials. The resulting polyimide films are colourless and transparent and are used as thermally stable flexible substrates for electronic devices. FFDA is also used in laser photolysis bimolecular electron transfer studies. | | Solubility in organics | 9,9-Bis(4-amino-3-fluorophenyl)fluorene (FFDA) is soluble in tetrahydrofuran, acetone, slightly soluble in ethanol, toluene. |
| | 9,9-BIS(4-AMINO-3-FLUOROPHENYL)FLUORENE Preparation Products And Raw materials |
|