(S)-(+)-3-BROMO-2-METHYL-1-PROPANOL manufacturers
|
| | (S)-(+)-3-BROMO-2-METHYL-1-PROPANOL Basic information |
| | (S)-(+)-3-BROMO-2-METHYL-1-PROPANOL Chemical Properties |
| Boiling point | 177.5±0.0 °C(Predicted) | | density | 1.461 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.483(lit.) | | Fp | 198 °F | | storage temp. | 2-8°C | | form | liquid | | pka | 14?+-.0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | Optical Rotation | [α]25/D +7.3°, c = 2 in chloroform | | BRN | 4738280 | | InChI | InChI=1S/C4H9BrO/c1-4(2-5)3-6/h4,6H,2-3H2,1H3/t4-/m1/s1 | | InChIKey | KIBOHRIGZMLNNS-SCSAIBSYSA-N | | SMILES | C(O)[C@H](C)CBr |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | F | 9 |
| | (S)-(+)-3-BROMO-2-METHYL-1-PROPANOL Usage And Synthesis |
| Uses | (2S)-3-Bromo-2-methyl-1-propanol is used as a reagent in the preparation of of pyrazolopyrimidinamine derivatives and their tyrosine and phosphinositide kinase inhibitory activity. | | Uses | (S)-(+)-3-Bromo-2-methyl-1-propanol is a precursor to synthesize the phase II mexiletine metabolite, (R)-mexiletine N-carbonyloxy-β-D-glucuronide. It can be used in the synthesis of (R)-(+)-muscopyridine, polycavernoside A and (+)-allopumiliotoxin 323B′. It can also be employed in building homochiral porous molecular networks. |
| | (S)-(+)-3-BROMO-2-METHYL-1-PROPANOL Preparation Products And Raw materials |
|