|
| 2-BROMO-1-PHENYLPROPANE Basic information |
| 2-BROMO-1-PHENYLPROPANE Chemical Properties |
Melting point | -10°C (estimate) | Boiling point | 107-109 °C/16 mmHg (lit.) | density | 1.291 g/mL at 25 °C (lit.) | refractive index | n20/D 1.545(lit.) | Fp | 195 °F | storage temp. | Store at room temperature | form | liquid | color | Very faint yellow | InChI | InChI=1S/C9H11Br/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3 | InChIKey | NVYOCAOZCSNIHR-UHFFFAOYSA-N | SMILES | C1(CC(Br)C)=CC=CC=C1 | CAS DataBase Reference | 2114-39-8(CAS DataBase Reference) |
Hazard Codes | Xi | Risk Statements | 36/37/38 | Safety Statements | 26 | RIDADR | NA 1993 / PGIII | WGK Germany | 3 | HS Code | 2903998090 |
| 2-BROMO-1-PHENYLPROPANE Usage And Synthesis |
Chemical Properties | clear colorless to light brown liquid |
| 2-BROMO-1-PHENYLPROPANE Preparation Products And Raw materials |
|