|
|
| | 3-Methoxy-2-methylbenzoic acid Basic information |
| | 3-Methoxy-2-methylbenzoic acid Chemical Properties |
| Melting point | 147.0 to 151.0 °C | | Boiling point | 138 °C(Press: 16 Torr) | | density | 1.168±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.83±0.10(Predicted) | | form | powder to crystal | | color | White to Yellow to Orange | | Water Solubility | Soluble in methanol. Insoluble in water. | | BRN | 510395 | | InChI | InChI=1S/C9H10O3/c1-6-7(9(10)11)4-3-5-8(6)12-2/h3-5H,1-2H3,(H,10,11) | | InChIKey | JPCISVSOTKMFPG-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC(OC)=C1C | | CAS DataBase Reference | 55289-06-0(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | HS Code | 2916399090 |
| Provider | Language |
|
ALFA
| English |
| | 3-Methoxy-2-methylbenzoic acid Usage And Synthesis |
| Chemical Properties | This product is solid and insoluble in water. | | Uses | 3-Methoxy-2-methylbenzoic acid is used as a Corey-Bakshi-Shibata oxazaborolidine catalyst for asymmetric reduction and asymmetric synthesis. It is used in the asymmetric reduction of prochiral ketones. Other applications include the enantioselective synthesis of α-hydroxy acids, α-amino acids, C2 symmetrical ferrocenyl diols and propargyl alcohols. It is also used in desymmetrizing reduction leading to (S)-4-hydroxycyclohexenone. |
| | 3-Methoxy-2-methylbenzoic acid Preparation Products And Raw materials |
|