- Z-MEALA-OH
-
- $1.00 / 1KG
-
2020-01-13
- CAS:21691-41-8
- Min. Order: 1g
- Purity: 99.0%
- Supply Ability: 100kg
|
| | Z-MEALA-OH Basic information |
| Product Name: | Z-MEALA-OH | | Synonyms: | BENZYLOXYCARBONYL-N-METHYL-L-ALANINE;N-Benzyloxycarbonyl-N-methyl-L-alanine;2-[benzyloxycarbonyl(methyl)amino]propionic acid;2-[methyl(phenylmethoxycarbonyl)amino]propanoic acid;Z-L-MEALA-OH;Z-MEALA-OH;Z-METHYL-L-ALANINE;Z-N-ME-ALANINE | | CAS: | 21691-41-8 | | MF: | C12H15NO4 | | MW: | 237.25 | | EINECS: | 1533716-785-6 | | Product Categories: | | | Mol File: | 21691-41-8.mol |  |
| | Z-MEALA-OH Chemical Properties |
| Melting point | 54-56℃ | | Boiling point | 389.5±31.0 °C(Predicted) | | density | 1.222 | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 4.01±0.10(Predicted) | | form | Powder | | color | White to off-white | | Optical Rotation | Consistent with structure | | Major Application | peptide synthesis | | InChI | 1S/C12H15NO4/c1-9(11(14)15)13(2)12(16)17-8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3,(H,14,15)/t9-/m0/s1 | | InChIKey | QGEQKVZQPWSOTI-VIFPVBQESA-N | | SMILES | C[C@H](N(C)C(=O)OCc1ccccc1)C(O)=O | | CAS DataBase Reference | 21691-41-8(CAS DataBase Reference) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Z-MEALA-OH Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | Z-MEALA-OH Preparation Products And Raw materials |
|