|
|
| | (R)-3-Isopropyl-2,5-piperazinedione Basic information |
| | (R)-3-Isopropyl-2,5-piperazinedione Chemical Properties |
| Melting point | 258-262 °C(lit.) | | alpha | -31.5 º (c=1, water) | | Boiling point | 280.42°C (rough estimate) | | density | 1.1832 (rough estimate) | | refractive index | 1.4880 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 13.12±0.40(Predicted) | | Optical Rotation | [α]20/D 31.5°, c = 1 in H2O | | Water Solubility | 23 g/L (22 ºC) | | BRN | 82869 | | InChI | InChI=1S/C7H12N2O2/c1-4(2)6-7(11)8-3-5(10)9-6/h4,6H,3H2,1-2H3,(H,8,11)(H,9,10)/t6-/m1/s1 | | InChIKey | IULFBTHVPRNQCG-ZCFIWIBFSA-N | | SMILES | N1CC(=O)N[C@H](C(C)C)C1=O |
| | (R)-3-Isopropyl-2,5-piperazinedione Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | (R)-3-Isopropyl-2,5-piperazinedione acts as a useful reagent in the synthesis of (R)-2,5-dihydro-3,6-dimethoxy-2-isopropylpyrazine. | | Uses | Chiral auxiliary developed by Professor Schllkopf for the enantioselective synthesis of α-amino acids. |
| | (R)-3-Isopropyl-2,5-piperazinedione Preparation Products And Raw materials |
| Raw materials | Glycine, N-[(1,1-dimethylethoxy)carbonyl]-D-valyl-, ethyl ester-->Glycine, N-[(phenylmethoxy)carbonyl]-D-valyl-, methyl ester-->Glycine, N-[(1,1-dimethylethoxy)carbonyl]-D-valyl-, methyl ester-->Cbz-D-Valine-->Boc-D-Valine-->(R)-4-ISO-PROPYL-OXAZOLIDINE-2,5-DIONE-->D-Valine-->ethyl glycinate | | Preparation Products | Nsc524129-->(R)-2,5-Dihydro-3,6-diethoxy-2-isopropylpyrazine-->(R)-2,5-Dihydro-3,6-dimethoxy-2-isopropylpyrazine |
|