|
|
| | GUGGULSTERONE E Basic information |
| Product Name: | GUGGULSTERONE E | | Synonyms: | 4,17(20)-(TRANS)-PREGNADIEN-3,16-DIONE;GS, TRANS;GUGGULESTERONE E;GUGGULSTERONE;GUGGULSTERONE E;GUGGULSTERONE (E FORM);TRANS-4,17(20)-PREGNADIENE-3,16-DIONE;TRANS-GUGGULSTERONE | | CAS: | 39025-24-6 | | MF: | C21H28O2 | | MW: | 312.45 | | EINECS: | | | Product Categories: | | | Mol File: | 39025-24-6.mol |  |
| | GUGGULSTERONE E Chemical Properties |
| Melting point | 170-171.5° | | alpha | D26 -30° (c = 1 in chloroform) | | Boiling point | 463℃ | | density | 1.10 | | Fp | 172℃ | | storage temp. | 2-8°C | | solubility | DMSO: soluble5mg/mL | | form | powder | | color | white to off-white | | InChI | InChI=1S/C21H28O2/c1-4-16-19(23)12-18-15-6-5-13-11-14(22)7-9-20(13,2)17(15)8-10-21(16,18)3/h4,11,15,17-18H,5-10,12H2,1-3H3/b16-4-/t15-,17+,18+,20+,21-/m1/s1 | | InChIKey | WDXRGPWQVHZTQJ-AUKWTSKRSA-N | | SMILES | C1(=O)C=C2[C@](C)(CC1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](CC1)(C)/C(=C\C)/C(=O)C3)CC2 | | LogP | 3.650 (est) |
| Hazard Codes | Xi | | Risk Statements | 37-52/53 | | Safety Statements | 61-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 3 STOT SE 3 |
| | GUGGULSTERONE E Usage And Synthesis |
| Uses | (E)-Guggulsterone acts as an α-glucosidase inhibitor also known as a hypolipidemic agent. | | Definition | ChEBI: E-Guggulsterone is a 3-hydroxy steroid. It has a role as an androgen. |
| | GUGGULSTERONE E Preparation Products And Raw materials |
|