| Company Name: |
SunaTech Inc. |
| Tel: |
0512-62872180 18994314770 |
| Email: |
sales@sunatech.com |
2,2',7,7'-Tetraamino-9,9'-spirobifluorene manufacturers
|
| | 2,2',7,7'-Tetraamino-9,9'-spirobifluorene Basic information |
| Product Name: | 2,2',7,7'-Tetraamino-9,9'-spirobifluorene | | Synonyms: | 2,2',7,7'-Tetraamino-9,9'-spirobifluorene;2,2',7,7'-tetraamino-9,9'-spirobi[9H-fluorene];IN1649, 9,9'-Spirobi[9H-fluorene]-2,2',7,7'-tetramine;9,9'-Spirobi[9H-fluorene]-2,2',7,7'-tetramine;9,9'-spirobi[fluorene]-2,2',7,7'-tetraamine | | CAS: | 376356-61-5 | | MF: | C25H20N4 | | MW: | 376.45 | | EINECS: | | | Product Categories: | | | Mol File: | 376356-61-5.mol |  |
| | 2,2',7,7'-Tetraamino-9,9'-spirobifluorene Chemical Properties |
| Melting point | >210 °C (decomp) | | Boiling point | 728.0±60.0 °C(Predicted) | | density | 1.45±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 4.59±0.20(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C25H20N4/c26-13-1-5-17-18-6-2-14(27)10-22(18)25(21(17)9-13)23-11-15(28)3-7-19(23)20-8-4-16(29)12-24(20)25/h1-12H,26-29H2 | | InChIKey | PTQXFKFYBWOKTN-UHFFFAOYSA-N | | SMILES | C12(C3=C(C=CC(N)=C3)C3=C1C=C(N)C=C3)C1=C(C=CC(N)=C1)C1=C2C=C(N)C=C1 |
| | 2,2',7,7'-Tetraamino-9,9'-spirobifluorene Usage And Synthesis |
| Uses | 2,2',7,7'-Tetraamino-9,9'-spirobifluorene is used as a monomer for the synthesis of COF materials: Porous Hydrogen-Bonded Networks; azo-linked polymers ALP-5; Spiro-PDI. |
| | 2,2',7,7'-Tetraamino-9,9'-spirobifluorene Preparation Products And Raw materials |
|