|
|
| | (2S)-2-Amino-8-nonenoic acid.HCl Basic information |
| Product Name: | (2S)-2-Amino-8-nonenoic acid.HCl | | Synonyms: | (2S)-2-Amino-8-nonenoic acid.HCl;(S)-2-aminonon-8-enoicacidhydrochloride;(2S)-2-Amino-8-nonenoic acid hydrochloride;(2S)-2-(6'-heptenyl)glycine.HCl;hydrochloride - [A81302];(2S)-2-amino-8-nonyleneacidhydrochloride | | CAS: | 1078627-30-1 | | MF: | C9H18ClNO2 | | MW: | 207.7 | | EINECS: | | | Product Categories: | | | Mol File: | 1078627-30-1.mol |  |
| | (2S)-2-Amino-8-nonenoic acid.HCl Chemical Properties |
| storage temp. | Store at room temperature | | Appearance | White to off-white Solid | | InChI | InChI=1/C9H17NO2.ClH/c1-2-3-4-5-6-7-8(10)9(11)12;/h2,8H,1,3-7,10H2,(H,11,12);1H/t8-;/s3 | | InChIKey | OMKXKHQRAFCRGI-JNODIIHCNA-N | | SMILES | C(CCCCC=C)[C@H](N)C(=O)O.Cl |&1:7,r| |
| | (2S)-2-Amino-8-nonenoic acid.HCl Usage And Synthesis |
| | (2S)-2-Amino-8-nonenoic acid.HCl Preparation Products And Raw materials |
|