|
|
| | 1,1'-(p-phenylene)bis(urea) Basic information | | Uses |
| Product Name: | 1,1'-(p-phenylene)bis(urea) | | Synonyms: | 1,1'-(p-phenylene)bis(urea);Urea, 1,1'-p-phenylenedi- (6CI,7CI,8CI);1,1'-(1,4-isophenyl)diurea;1,1'-(1,4-phenylene)diurea | | CAS: | 1205-90-9 | | MF: | C8H10N4O2 | | MW: | 194.19 | | EINECS: | | | Product Categories: | | | Mol File: | 1205-90-9.mol |  |
| | 1,1'-(p-phenylene)bis(urea) Chemical Properties |
| Boiling point | 358.9±25.0 °C(Predicted) | | density | 1.494±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 14.24±0.70(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H10N4O2/c9-7(13)11-5-1-2-6(4-3-5)12-8(10)14/h1-4H,(H3,9,11,13)(H3,10,12,14) | | InChIKey | DPRNGQDPBFKLCK-UHFFFAOYSA-N | | SMILES | C1(NC(N)=O)=CC=C(NC(N)=O)C=C1 |
| | 1,1'-(p-phenylene)bis(urea) Usage And Synthesis |
| Uses | 1,1'-(1,4-phenylene)diurea is mainly used in organic synthesis. |
| | 1,1'-(p-phenylene)bis(urea) Preparation Products And Raw materials |
|