|
|
| | 3-Iodo-4-methylbenzoic acid Basic information |
| | 3-Iodo-4-methylbenzoic acid Chemical Properties |
| Melting point | 210-212 °C (lit.) | | Boiling point | 278.5°C (rough estimate) | | density | 1.7835 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Soluble in methanol. | | form | Solid | | pka | 4.02±0.10(Predicted) | | color | Off-White | | Sensitive | Light Sensitive | | BRN | 2436216 | | InChI | InChI=1S/C8H7IO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4H,1H3,(H,10,11) | | InChIKey | LDDHMKANNXWUAK-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(C)C(I)=C1 | | CAS DataBase Reference | 82998-57-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-Iodo-4-methylbenzoic acid Usage And Synthesis |
| Chemical Properties | beige to brown crystalline powder | | Uses | 3-Iodo-4-methylbenzoic acid has been used in the preparation of unlabeled N-succinimidyl 4-guanidinomethyl-3-iodobenzoate (SGIMB) and boc-protected derivative of SGIMB (Boc-SGMIB). | | Synthesis | The general procedure for the synthesis of 3-iodo-4-methylbenzoic acid from methyl 3-iodo-4-methylbenzoate was as follows: methyl 3-iodo-4-methylbenzoate (3 g, 10.9 mmol, 1 eq.) was dissolved in methanol (30 mL), followed by addition of sodium hydroxide (1.3 g, 32.7 mmol, 3 eq.) and water (15 mL). The reaction mixture was stirred at room temperature for 14 hours. Upon completion of the reaction, the solution was concentrated under reduced pressure and subsequently diluted with the addition of water. The pH of the reaction mixture was adjusted with concentrated hydrochloric acid to 3. The precipitated solid was collected by filtration and dried under reduced pressure to afford the target product 3-iodo-4-methylbenzoic acid in a yield of 2.7 g (96% yield). The 1H NMR (400 MHz, DMSO-d6) data of the product were as follows: δ 2.44 (s, 3H), 7.45 (d, J=8.00 Hz, 1H), 7.85 (d, J=3.18 Hz, 1H), 8.31 (s, 1H). | | References | [1] Patent: WO2010/30538, 2010, A2. Location in patent: Page/Page column 197
[2] Patent: WO2011/112186, 2011, A1. Location in patent: Page/Page column 196
[3] Bioorganic and Medicinal Chemistry Letters, 2009, vol. 19, # 17, p. 5004 - 5008 |
| | 3-Iodo-4-methylbenzoic acid Preparation Products And Raw materials |
|