NSC49652 manufacturers
- NSC49652
-
- $31.00
-
2026-08-08
- CAS:908563-68-8
- Purity: 98.98%
- Supply Ability: 10g
|
| | NSC49652 Basic information |
| Product Name: | NSC49652 | | Synonyms: | NSC49652;(2E)-1-(2-hydroxyphenyl)-3-(pyridin-3-yl)prop-2-en-1-one;2-Propen-1-one, 1-(2-hydroxyphenyl)-3-(3-pyridinyl)-, (2E)-;(2E)-1-(2-Hydroxyphenyl)-3-(3-pyridinyl)-2-propenone;NSC49652, 10 mM in DMSO | | CAS: | 908563-68-8 | | MF: | C14H11NO2 | | MW: | 225.24 | | EINECS: | | | Product Categories: | | | Mol File: | 908563-68-8.mol |  |
| | NSC49652 Chemical Properties |
| Boiling point | 414.3±45.0 °C(Predicted) | | density | 1.241±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO : ≥ 20.83 mg/mL (92.48 mM) | | pka | 7.68±0.30(Predicted) | | form | Solid | | color | Light yellow to yellow | | InChI | 1S/C14H11NO2/c16-13-6-2-1-5-12(13)14(17)8-7-11-4-3-9-15-10-11/h1-10,16H/b8-7+ | | InChIKey | CRWNZUBUBIULHB-BQYQJAHWSA-N | | SMILES | OC1=CC=CC=C1C(/C=C/C2=CN=CC=C2)=O |
| WGK Germany | WGK 3 | | HS Code | 2914310000 | | Storage Class | 11 - Combustible Solids |
| | NSC49652 Usage And Synthesis |
| Uses | (2E)-1-(2-Hydroxyphenyl)-3-(3-pyridinyl)-2-propenone is used in the synthesis of 2,4,6-Trisubstituted Pyrimidines. | | Biological Activity | NSC49652 is a orally active, potent and selective inhibitor of death receptor p75NTR (p75 neurotrophin receptor) th at targets the interfaces between transmembrane domains (TMDs). NSC49652 induces profound conformational changes and triggers p75NTR dependent cancer cell death. It inhibits the growth of cancer in melanoma mouse model. |
| | NSC49652 Preparation Products And Raw materials |
|