| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | L-Glutamine-13C5, 15N2, d10 Basic information |
| | L-Glutamine-13C5, 15N2, d10 Chemical Properties |
| Melting point | 185 °C (dec.)(lit.) | | form | solid | | Optical Rotation | [α]25/D +33.0°, c =2 in 5 M HCl | | InChI | 1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1/i1+1D2,2+1D2,3+1D,4+1,5+1,6+1,7+1/hD5 | | InChIKey | ZDXPYRJPNDTMRX-STHRCCDNSA-N | | SMILES | [2H]O[13C](=O)[13C@@]([2H])([15N]([2H])[2H])[13C]([2H])([2H])[13C]([2H])([2H])[13C](=O)[15N]([2H])[2H] |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-Glutamine-13C5, 15N2, d10 Usage And Synthesis |
| | L-Glutamine-13C5, 15N2, d10 Preparation Products And Raw materials |
|