- Fmoc-L-HomoPhe-OH
-
-
2026-08-21
- CAS:132684-59-4
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
|
| | FMOC-L-HOMOPHENYLALANINE Basic information |
| | FMOC-L-HOMOPHENYLALANINE Chemical Properties |
| Melting point | 141.0 to 145.0 °C | | Boiling point | 628.3±50.0 °C(Predicted) | | density | 1.254 | | storage temp. | 2-8°C | | pka | 3.84±0.10(Predicted) | | form | White solid. | | color | White to Almost white | | Water Solubility | Slightly soluble in water. | | BRN | 4847669 | | Major Application | peptide synthesis | | InChI | InChI=1/C25H23NO4/c27-24(28)23(15-14-17-8-2-1-3-9-17)26-25(29)30-16-22-20-12-6-4-10-18(20)19-11-5-7-13-21(19)22/h1-13,22-23H,14-16H2,(H,26,29)(H,27,28)/t23-/s3 | | InChIKey | CIHPCIUGLIZADU-CRPMJUFNNA-N | | SMILES | C1(COC(=O)N[C@H](C(=O)O)CCC2C=CC=CC=2)C2C=CC=CC=2C2C=CC=CC1=2 |&1:6,r| | | CAS DataBase Reference | 132684-59-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-44-35-28-7-4 | | WGK Germany | 3 | | HS Code | 2924 29 70 | | HazardClass | IRRITANT | | Storage Class | 13 - Non Combustible Solids |
| | FMOC-L-HOMOPHENYLALANINE Usage And Synthesis |
| Chemical Properties | White powder | | Uses | It is used as an active pharmaceutical intermediate. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-L-HOMOPHENYLALANINE Preparation Products And Raw materials |
|