|
|
| | (-)-Dimethyl D-tartrate Basic information |
| | (-)-Dimethyl D-tartrate Chemical Properties |
| Melting point | 57-60 °C (dec.)(lit.) | | alpha | -21 º (c=10, H2O) | | Boiling point | 158 °C0.2 mm Hg(lit.) | | density | 1.30 | | refractive index | -21 ° (C=1, H2O) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | pka | 11.44±0.20(Predicted) | | color | White to Almost white | | Optical Rotation | [α]20/D 21°, c = 2.5 in H2O | | BRN | 1726254 | | InChI | InChI=1S/C6H10O6/c1-11-5(9)3(7)4(8)6(10)12-2/h3-4,7-8H,1-2H3/t3-,4-/m0/s1 | | InChIKey | PVRATXCXJDHJJN-IMJSIDKUSA-N | | SMILES | C(OC)(=O)[C@@H](O)[C@H](O)C(OC)=O | | CAS DataBase Reference | 13171-64-7(CAS DataBase Reference) | | NIST Chemistry Reference | (-)-Dimethyl D-tartrate(13171-64-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36/37-26 | | WGK Germany | 3 | | HS Code | 29181300 | | Storage Class | 11 - Combustible Solids |
| | (-)-Dimethyl D-tartrate Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui |
| | (-)-Dimethyl D-tartrate Preparation Products And Raw materials |
|