- Ethylene Deltenone
-
- $0.00 / 1Kg/Bag
-
2026-05-15
- CAS:5571-36-8
- Min. Order: 1KG
- Purity: 99%min
- Supply Ability: 500KGS
|
| | Estradiene dione-3-keta Basic information | | Uses |
| | Estradiene dione-3-keta Chemical Properties |
| Melting point | 152-154°C | | Boiling point | 488.1±45.0 °C(Predicted) | | density | 1.20±0.1 g/cm3(Predicted) | | vapor pressure | 0Pa at 25℃ | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Sparingly, Heated, Sonicated), Methanol (Slightly) | | form | Solid | | color | White to Light Yellow | | Optical Rotation | Consistent with structure | | Water Solubility | 903μg/L at 25℃ | | InChI | InChI=1/C20H26O3/c1-19-8-6-15-14-7-9-20(22-10-11-23-20)12-13(14)2-3-16(15)17(19)4-5-18(19)21/h6,16-17H,2-5,7-12H2,1H3/t16-,17+,19+/s3 | | InChIKey | XUOQKQRMICQUQC-GDJQEYATNA-N | | SMILES | C[C@@]12C(CC[C@@]1([H])[C@]1([H])CCC3CC4(OCCO4)CCC=3C1=CC2)=O |&1:1,5,7,r| | | LogP | 4.74 |
| RIDADR | 3077 | | HS Code | 2937.23.5050 | | HazardClass | 9 | | PackingGroup | III |
| | Estradiene dione-3-keta Usage And Synthesis |
| Uses | 3-Ketal is used as an intermediate for mifepristone; it is also used as an anti-progestin and anti-glucocorticoid antagonist, steroid spiroxazole. | | Chemical Properties | Off-White Solid |
| | Estradiene dione-3-keta Preparation Products And Raw materials |
|