Company Name: |
Creasyn Finechem(Tianjin) Co., Ltd.
|
Tel: |
022-83946278 13820503911 |
Email: |
sales@creasyn.com |
Products Intro: |
Product Name:1-ethenyl-4-propan-2-ylbenzene CAS:2055-40-5 Purity:95% Package:1KG;5KG;25KG;100KG;1000KG
|
|
| 4-ISO-PROPYL STYRENE Basic information |
Product Name: | 4-ISO-PROPYL STYRENE | Synonyms: | benzene,1-ethenyl-4-(1-methylethyl)-;p-isopropylstyrene;styrene,p-isopropyl-;4-ISO-PROPYL STYRENE;1-Isopropyl-4-vinylbenzene;1-ethenyl-4-propan-2-ylbenzene;1-ethenyl-4-propan-2-yl-benzene;Isopropyl-4-vinylbenzene | CAS: | 2055-40-5 | MF: | C11H14 | MW: | 146.23 | EINECS: | 218-151-8 | Product Categories: | monomer | Mol File: | 2055-40-5.mol |  |
| 4-ISO-PROPYL STYRENE Chemical Properties |
Melting point | -44.7°C | Boiling point | 80°C 20mm | density | 0.8850 | refractive index | 1.5289 | InChI | InChI=1S/C11H14/c1-4-10-5-7-11(8-6-10)9(2)3/h4-9H,1H2,2-3H3 | InChIKey | QQHQTCGEZWTSEJ-UHFFFAOYSA-N | SMILES | C1(C=C)=CC=C(C(C)C)C=C1 |
| 4-ISO-PROPYL STYRENE Usage And Synthesis |
| 4-ISO-PROPYL STYRENE Preparation Products And Raw materials |
|